CAS 79100-27-9
:ethyl [(5,6-dichloro-1H-imidazo[4,5-b]pyrazin-2-yl)sulfanyl]acetate
Description:
Ethyl [(5,6-dichloro-1H-imidazo[4,5-b]pyrazin-2-yl)sulfanyl]acetate is a chemical compound characterized by its complex structure, which includes an imidazo[4,5-b]pyrazine core substituted with dichloro and sulfanyl groups. The presence of the ethyl acetate moiety suggests that it is an ester, which typically contributes to its solubility in organic solvents and potential volatility. The dichloro substituents indicate that the compound may exhibit unique reactivity and biological activity, potentially influencing its pharmacological properties. The sulfanyl group can enhance the compound's nucleophilicity, making it reactive in various chemical reactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its heterocyclic structure, which is often associated with bioactive compounds. Additionally, the specific arrangement of atoms and functional groups can affect its stability, reactivity, and interaction with biological targets. Overall, ethyl [(5,6-dichloro-1H-imidazo[4,5-b]pyrazin-2-yl)sulfanyl]acetate represents a unique chemical entity with potential applications in various fields, including drug discovery and development.
Formula:C9H8Cl2N4O2S
InChI:InChI=1/C9H8Cl2N4O2S/c1-2-17-4(16)3-18-9-14-7-8(15-9)13-6(11)5(10)12-7/h2-3H2,1H3,(H,12,13,14,15)
Synonyms:- Aceticacid, 2-[(5,6-dichloro-1H-imidazo[4,5-b]pyrazin-2-yl)thio]-, ethyl ester
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
NSC-217913
CAS:<p>NSC-217913 acts as an inhibitor of WWP1, exhibiting an IC50 value of 158.3 μM.</p>Formula:C9H8Cl2N4O2SColor and Shape:SolidMolecular weight:307.16
