CAS 791060-66-7

(2S,4S)-4-Fluoro-2-pyrrolidinemethanol

Description:

(2S,4S)-4-Fluoro-2-pyrrolidinemethanol is a chiral organic compound characterized by its pyrrolidine ring structure, which contains a fluorine atom at the 4-position and a hydroxymethyl group at the 2-position. This compound is notable for its stereochemistry, as indicated by the (2S,4S) designation, which refers to the specific spatial arrangement of its atoms. The presence of the fluorine atom can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The hydroxymethyl group contributes to its potential as a building block in organic synthesis. Additionally, the compound's chirality may affect its interactions with biological systems, including enzyme binding and receptor activity. As a result, (2S,4S)-4-Fluoro-2-pyrrolidinemethanol may exhibit unique pharmacological properties, which could be explored in various therapeutic contexts. Its CAS number, 791060-66-7, provides a unique identifier for regulatory and research purposes.

Formula: C₅H₁₀FNO

InChI: InChI=1/C5H10FNO/c6-4-1-5(3-8)7-2-4/h4-5,7-8H,1-3H2/t4-,5-/m0/s1

SMILES: C1[C@@H](CN[C@@H]1CO)F

Synonyms:

• [(2S,4S)-4-Fluoropyrrolidin-2-yl]methanol
• 2-pyrrolidinemethanol, 4-fluoro-, (2S,4S)-