CymitQuimica logo

CAS 791137-29-6

:

5-Bromo-2-hydroxy-3-nitrobenzamide

Description:
5-Bromo-2-hydroxy-3-nitrobenzamide is an organic compound characterized by its aromatic structure, which includes a bromine atom, a hydroxyl group, and a nitro group attached to a benzamide moiety. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The hydroxyl group contributes to its potential as a hydrogen bond donor, while the nitro group is known for its electron-withdrawing properties, which can affect the compound's overall electronic characteristics and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's stability and solubility in various solvents can vary, influencing its practical applications in laboratory settings. As with many nitro-substituted compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental impact.
Formula:C7H5BrN2O4
InChI:InChI=1S/C7H5BrN2O4/c8-3-1-4(7(9)12)6(11)5(2-3)10(13)14/h1-2,11H,(H2,9,12)
InChI key:InChIKey=SSGZMICESZQDHU-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(O)C(N(=O)=O)=CC(Br)=C1
Synonyms:
  • 5-Bromo-2-hydroxy-3-nitrobenzamide
  • Salicylamide, 5-bromo-3-nitro-
  • Benzamide, 5-bromo-2-hydroxy-3-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.