CAS 79124-75-7
:3-(4-Methylphenoxy)benzaldehyde
Description:
3-(4-Methylphenoxy)benzaldehyde, with the CAS number 79124-75-7, is an organic compound characterized by its aromatic structure. It features a benzaldehyde functional group, which is a key characteristic of aldehydes, and a 4-methylphenoxy substituent that enhances its chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its pleasant aromatic odor, making it potentially useful in fragrance applications. The presence of both the aldehyde and ether functionalities suggests that it may participate in various chemical reactions, including nucleophilic additions and electrophilic substitutions. Additionally, it may exhibit moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 3-(4-Methylphenoxy)benzaldehyde is of interest in organic synthesis and potentially in the development of specialty chemicals.
Formula:C14H12O2
InChI:InChI=1S/C14H12O2/c1-11-5-7-13(8-6-11)16-14-4-2-3-12(9-14)10-15/h2-10H,1H3
InChI key:InChIKey=ASKLCRGXIJGVOY-UHFFFAOYSA-N
SMILES:O(C1=CC(C=O)=CC=C1)C2=CC=C(C)C=C2
Synonyms:- 3-(4-Methylphenoxy)benzaldehyde
- m-(p-Methylphenoxy)benzaldehyde
- Benzaldehyde, 3-(4-methylphenoxy)-
- 3-p-Tolyloxybenzaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
