CAS 79127-24-5
:10-{[(5-chloronaphthalen-1-yl)sulfonyl]amino}decan-1-aminium chloride
Description:
10-{[(5-chloronaphthalen-1-yl)sulfonyl]amino}decan-1-aminium chloride, with the CAS number 79127-24-5, is a quaternary ammonium compound characterized by its long aliphatic chain and a sulfonamide functional group. This compound features a decyl chain, which contributes to its hydrophobic properties, while the presence of the 5-chloronaphthalen-1-yl sulfonyl group imparts unique electronic and steric characteristics. The quaternary ammonium structure indicates that it carries a positive charge, making it soluble in polar solvents, particularly water. Its chloride counterion enhances its solubility and stability in various formulations. This compound may exhibit antimicrobial properties due to its quaternary ammonium nature, which is common in similar compounds. Additionally, its structural features suggest potential applications in fields such as pharmaceuticals, materials science, and as a surfactant. The presence of the chloronaphthalene moiety may also influence its biological activity and interactions with other molecules. Overall, this compound represents a versatile structure with potential utility in various chemical and biological applications.
Formula:C20H30Cl2N2O2S
InChI:InChI=1/C20H29ClN2O2S.ClH/c21-19-13-9-12-18-17(19)11-10-14-20(18)26(24,25)23-16-8-6-4-2-1-3-5-7-15-22;/h9-14,23H,1-8,15-16,22H2;1H
SMILES:C(CCCCCNS(=O)(=O)c1cccc2c1cccc2Cl)CCCCN.Cl
Synonyms:- 1-Naphthalenesulfonamide, N-(10-aminodecyl)-5-chloro-, hydrochloride (1:1)
- N-(10-Aminodecyl)-5-chloronaphthalene-1-sulfonamide hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
A-7 hydrochloride
CAS:<p>Calmodulin antagonist</p>Formula:C20H30Cl2N2O2SColor and Shape:Powder or crystals or crystalline powder, Pale yellow to yellowMolecular weight:433.43N-(10-Aminodec-1-yl)-5-chloronaphthalene-1-sulphonamide hydrochloride
CAS:<p>N-(10-Aminodec-1-yl)-5-chloronaphthalene-1-sulphonamide hydrochloride</p>Purity:≥95%Molecular weight:433.44g/molN-(10-Aminodecyl)-5-chloro-1-naphthalenesulfonamide Hydrochloride
CAS:Controlled Product<p>Applications Naphthalenesulfonamides derivatives are neoplasm inhibitors.<br>References Hidaka, H., et al.: Proc. Nat. Acad. Sci. USA, 78, 4354 (1981)<br></p>Formula:C20H29ClN2O2S·ClHColor and Shape:NeatMolecular weight:433.44A-7 hydrochloride
CAS:<p>A-7 hydrochloride is a calmodulin antagonist and causes alterations in the subpopulation of CD44+CD24- in MDA-MB-231 cells.</p>Formula:C20H30Cl2N2O2SPurity:99.38%Color and Shape:SolidMolecular weight:433.44



