CAS 79128-08-8

1,3-bis(1-methylethoxy)benzene

Description:

1,3-bis(1-methylethoxy)benzene, also known by its CAS number 79128-08-8, is an organic compound characterized by its structure, which features a benzene ring substituted at the 1 and 3 positions with 1-methylethoxy groups. This compound is a type of alkoxybenzene, which typically exhibits properties such as moderate volatility and solubility in organic solvents. The presence of the bulky 1-methylethoxy groups can influence its physical properties, including its boiling point and melting point, making it less polar compared to simpler phenolic compounds. It may also exhibit hydrophobic characteristics due to the long alkyl chains, which can affect its interactions in various chemical environments. Additionally, this compound may have applications in organic synthesis or as an intermediate in the production of other chemical substances. Safety data should be consulted for handling and storage, as with any chemical, to ensure proper safety measures are taken.

Formula: C₁₂H₁₈O₂

InChI: InChI=1/C12H18O2/c1-9(2)13-11-6-5-7-12(8-11)14-10(3)4/h5-10H,1-4H3

SMILES: CC(C)Oc1cccc(c1)OC(C)C

Synonyms:

• 1,3-Diisopropoxybenzene

1,3-Diisopropoxybenzene

CAS: 79128-08-8

Formula: C₁₂H₁₈O₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 194.2701

Ref: IN-DA003DK2

1,3-Diisopropoxybenzene

CAS: 79128-08-8

1,3-Diisopropoxybenzene

Purity: 98%

Molecular weight: 194.27g/mol

Ref: 54-OR1009196