CAS 79128-09-9

1-(1-Methylethoxy)-3-(methylthio)benzene

Description:

1-(1-Methylethoxy)-3-(methylthio)benzene, with the CAS number 79128-09-9, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a methylethoxy group and a methylthio group. The presence of the methylethoxy group contributes to its potential as a solvent or in various chemical reactions, while the methylthio group can influence its reactivity and interactions with other substances. This compound is likely to exhibit moderate volatility and solubility in organic solvents, typical of many aromatic compounds. Its molecular structure suggests that it may participate in electrophilic aromatic substitution reactions, making it of interest in synthetic organic chemistry. Additionally, the presence of sulfur in the methylthio group may impart unique properties, such as increased reactivity or specific interactions with biological systems. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₀H₁₄OS

InChI: InChI=1S/C10H14OS/c1-8(2)11-9-5-4-6-10(7-9)12-3/h4-8H,1-3H3

InChI key: InChIKey=KYWCZKAPHSFDQE-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=CC(SC)=CC=C1

Synonyms:

• Benzene, 1-(1-methylethoxy)-3-(methylthio)-
• 1-Isopropoxy-3-(methylthio)benzene
• 1-(1-Methylethoxy)-3-(methylthio)benzene
• 1-(Methylsulfanyl)-3-(propan-2-yloxy)benzene