CymitQuimica logo

CAS 79128-70-4

:

methyl 3-(benzoylamino)thiophene-2-carboxylate

Description:
Methyl 3-(benzoylamino)thiophene-2-carboxylate is an organic compound characterized by its complex structure, which includes a thiophene ring, an amide functional group, and an ester group. The presence of the thiophene ring contributes to its aromatic properties, while the benzoylamino group enhances its potential for hydrogen bonding and reactivity. This compound typically exhibits moderate solubility in organic solvents due to its polar functional groups, while being less soluble in water. Its molecular structure suggests potential applications in pharmaceuticals, particularly in drug design, due to the presence of both the thiophene and amide functionalities, which are often found in biologically active compounds. Additionally, the compound may exhibit interesting electronic properties, making it a candidate for studies in materials science or organic electronics. Overall, methyl 3-(benzoylamino)thiophene-2-carboxylate is a versatile compound with potential applications across various fields of chemistry and materials science.
Formula:C13H11NO3S
InChI:InChI=1/C13H11NO3S/c1-17-13(16)11-10(7-8-18-11)14-12(15)9-5-3-2-4-6-9/h2-8H,1H3,(H,14,15)
SMILES:COC(=O)c1c(ccs1)N=C(c1ccccc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.