CAS 79133-14-5
:ethyl 4-amino-3-phenylbutanoate
Description:
Ethyl 4-amino-3-phenylbutanoate, with the CAS number 79133-14-5, is an organic compound characterized by its ester functional group and an amino group attached to a butanoate backbone. This compound typically appears as a white to off-white solid or crystalline substance. It is soluble in organic solvents, such as ethanol and methanol, but may have limited solubility in water due to its hydrophobic phenyl group. The presence of the amino group suggests that it can participate in various chemical reactions, including acylation and amination, making it a potential intermediate in organic synthesis. Ethyl 4-amino-3-phenylbutanoate may exhibit biological activity, which could be of interest in pharmaceutical applications, particularly in the development of drugs targeting specific receptors or pathways. Its molecular structure contributes to its physical and chemical properties, influencing its reactivity and interactions with other substances. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H17NO2
InChI:InChI=1/C12H17NO2/c1-2-15-12(14)8-11(9-13)10-6-4-3-5-7-10/h3-7,11H,2,8-9,13H2,1H3
Synonyms:- benzenepropanoic acid, beta-(aminomethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.