CAS 791563-64-9

(2E)-3-(2,5-Dimethoxyphenyl)-2-propen-1-amine

Description:

(2E)-3-(2,5-Dimethoxyphenyl)-2-propen-1-amine, identified by its CAS number 791563-64-9, is an organic compound characterized by its propenyl amine structure, which features a double bond between the second and third carbon atoms of the propenyl group. The presence of a 2,5-dimethoxyphenyl substituent indicates that the compound has two methoxy groups (-OCH3) attached to a phenyl ring at the 2 and 5 positions, contributing to its aromatic properties and potentially influencing its reactivity and biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, which can affect its interaction with biological targets. The presence of the amine functional group suggests potential for hydrogen bonding and reactivity in various chemical environments. As with many organic compounds, its solubility, stability, and reactivity can be influenced by factors such as pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1S/C11H15NO2/c1-13-10-5-6-11(14-2)9(8-10)4-3-7-12/h3-6,8H,7,12H2,1-2H3/b4-3+

InChI key: InChIKey=UBLRPXQMWQHSKH-ONEGZZNKSA-N

SMILES: C(=C/CN)\C1=C(OC)C=CC(OC)=C1

Synonyms:

• 2-Propen-1-amine, 3-(2,5-dimethoxyphenyl)-, (E)-
• (2E)-3-(2,5-Dimethoxyphenyl)-2-propen-1-amine
• 2-Propen-1-amine, 3-(2,5-dimethoxyphenyl)-, (2E)-