CAS 791582-32-6

α-Oxo-4-phenyl-1-piperazineacetic acid

Description:

α-Oxo-4-phenyl-1-piperazineacetic acid is a chemical compound characterized by its piperazine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features an α-oxo group, indicating the presence of a carbonyl group adjacent to a carboxylic acid, contributing to its acidic properties. The phenyl group attached to the piperazine ring enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The presence of both the piperazine and carboxylic acid functionalities suggests that this compound may exhibit interesting pharmacological properties, possibly acting as a ligand for various biological targets. Its molecular structure allows for potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in research or pharmaceutical development.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1S/C12H14N2O3/c15-11(12(16)17)14-8-6-13(7-9-14)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,16,17)

InChI key: InChIKey=GEVDWNOCZLFZOL-UHFFFAOYSA-N

SMILES: C(C(O)=O)(=O)N1CCN(CC1)C2=CC=CC=C2

Synonyms:

• α-Oxo-4-phenyl-1-piperazineacetic acid
• 2-Oxo-2-(4-phenylpiperazin-1-yl)acetic acid
• 1-Piperazineacetic acid, α-oxo-4-phenyl-

2-Oxo-2-(4-phenylpiperazin-1-yl)acetic acid

Controlled Product

CAS: 791582-32-6

Versatile small molecule scaffold

Formula: C₁₂H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 234.25 g/mol

Ref: 3D-RGB58232