CAS 791587-69-4

5-Cyano-2-furancarbonyl chloride

Description:

5-Cyano-2-furancarbonyl chloride is a chemical compound characterized by its unique structure, which includes a furan ring, a cyano group, and an acyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity, particularly due to the presence of the acyl chloride group, which can undergo nucleophilic substitution reactions. The cyano group contributes to its polarity and can participate in various chemical reactions, making it a useful intermediate in organic synthesis. Additionally, the furan ring imparts aromatic characteristics, which can influence the compound's stability and reactivity. 5-Cyano-2-furancarbonyl chloride is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, owing to its ability to serve as a building block for more complex molecules. As with many reactive chlorides, it should be handled with care, as it can be corrosive and may release toxic gases upon hydrolysis.

Formula: C₆H₂ClNO₂

InChI: InChI=1S/C6H2ClNO2/c7-6(9)5-2-1-4(3-8)10-5/h1-2H

InChI key: InChIKey=VLZZMVPPSQPHMQ-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1OC(C#N)=CC1

Synonyms:

• 5-Cyanofuran-2-carbonyl chloride
• 2-Furancarbonyl chloride, 5-cyano-
• 5-Cyano-2-furancarbonyl chloride