CAS 791595-74-9

6-bromo-1H-benzimidazol-2-amine

Description:

6-Bromo-1H-benzimidazol-2-amine is a chemical compound characterized by its structure, which consists of a benzimidazole core substituted with a bromine atom and an amino group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, including potential solubility in polar solvents and moderate stability under standard conditions. The presence of the bromine atom can influence its reactivity, making it a candidate for various chemical transformations, while the amino group may participate in hydrogen bonding and enhance its interaction with biological targets. This compound is of interest in medicinal chemistry and research due to its potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, its unique structural features may contribute to its biological activity, making it a subject of study in the context of drug discovery and development. As with many chemical substances, safety and handling precautions should be observed, given the potential hazards associated with brominated compounds.

Formula: C₇H₆BrN₃

InChI: InChI=1/C7H6BrN3/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H3,9,10,11)

SMILES: c1cc2c(cc1Br)[nH]c(=N)[nH]2

Synonyms:

• 2-Amino-5-bromobenzimidazole
• 5-bromo-1H-benzo[d]imidazol-2-amine

5-bromo-1H-1,3-benzodiazol-2-amine

CAS: 791595-74-9

Formula: C₇H₆BrN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 212.0466

Ref: IN-DA0036H0

6-Bromo-1H-benzimidazol-2-amine

CAS: 791595-74-9

6-Bromo-1H-benzimidazol-2-amine

Purity: 97%

Molecular weight: 212.05g/mol

Ref: 54-OR93823

2-Amino-5-bromobenzimidazole

CAS: 791595-74-9

Formula: C₇H₆BrN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 212.05

Ref: 10-F220069