CAS 791614-74-9

5-Bromo-2-benzothiazoleethanol

Description:

5-Bromo-2-benzothiazoleethanol is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety and a hydroxyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the hydroxyl group. The bromine substituent can influence its reactivity, making it a candidate for various chemical transformations, such as nucleophilic substitutions or coupling reactions. Additionally, compounds like 5-Bromo-2-benzothiazoleethanol may exhibit biological activity, which can be of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis, materials science, or as a building block in the development of more complex molecules. Safety and handling precautions should be observed, as with many brominated compounds, due to potential toxicity and environmental concerns. Overall, this compound represents a versatile structure with implications in both synthetic chemistry and biological applications.

Formula: C₉H₈BrNOS

InChI: InChI=1S/C9H8BrNOS/c10-6-1-2-8-7(5-6)11-9(13-8)3-4-12/h1-2,5,12H,3-4H2

InChI key: InChIKey=FJIMNGQMCBWDMO-UHFFFAOYSA-N

SMILES: C(CO)C1=NC=2C(S1)=CC=C(Br)C2

Synonyms:

• 2-(5-Bromo-1,3-benzothiazol-2-yl)ethan-1-ol
• 5-Bromo-2-benzothiazoleethanol
• 2-(5-Bromobenzothiazol-2-yl)ethanol
• 2-Benzothiazoleethanol, 5-bromo-