CymitQuimica logo

CAS 791616-60-9

:

(1R)-3,3′-Bis(4-nitrophenyl)[1,1′-binaphthalene]-2,2′-diol

Description:
(1R)-3,3′-Bis(4-nitrophenyl)[1,1′-binaphthalene]-2,2′-diol is a chiral organic compound notable for its structural complexity and potential applications in asymmetric synthesis and catalysis. This compound features a binaphthalene backbone, which is a key structural motif in many chiral ligands and catalysts. The presence of two nitrophenyl groups enhances its electronic properties, making it useful in various chemical reactions, particularly in the field of organic electronics and photochemistry. The hydroxyl groups in the diol structure contribute to its solubility and reactivity, allowing for hydrogen bonding interactions. Additionally, the chirality of the compound can lead to enantioselective reactions, which are crucial in the synthesis of pharmaceuticals and fine chemicals. Its unique combination of functional groups and stereochemistry makes it a valuable compound for research in synthetic organic chemistry and materials science. Overall, (1R)-3,3′-Bis(4-nitrophenyl)[1,1′-binaphthalene]-2,2′-diol exemplifies the intersection of structural complexity and functional versatility in organic compounds.
Formula:C32H20N2O6
InChI:InChI=1S/C32H20N2O6/c35-31-27(19-9-13-23(14-10-19)33(37)38)17-21-5-1-3-7-25(21)29(31)30-26-8-4-2-6-22(26)18-28(32(30)36)20-11-15-24(16-12-20)34(39)40/h1-18,35-36H
InChI key:InChIKey=MCKOBOYULUSWGP-UHFFFAOYSA-N
SMILES:OC1=C(C2=C(C=C1C3=CC=C(N(=O)=O)C=C3)C=CC=C2)C=4C5=C(C=C(C4O)C6=CC=C(N(=O)=O)C=C6)C=CC=C5
Synonyms:
  • [1,1′-Binaphthalene]-2,2′-diol, 3,3′-bis(4-nitrophenyl)-, (1R)-
  • (1R)-3,3′-Bis(4-nitrophenyl)[1,1′-binaphthalene]-2,2′-diol
  • R-3,3'-bis(4-nitrophenyl)-1,1'-Binaphthalene]-2,2'-diol
  • (R)-3,3'-Bis(4-nitrophenyl)-[1,1'-binapthalene]-2,2'-diol
Found 4 products.