CAS 79172-43-3

1-Benzoylcyclopropanecarboxylic acid

Description:

1-Benzoylcyclopropanecarboxylic acid is an organic compound characterized by its unique cyclopropane structure fused with a benzoyl group and a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is known for its potential applications in organic synthesis and medicinal chemistry. The presence of the benzoyl group contributes to its reactivity, making it a useful intermediate in various chemical reactions, including acylation and cyclization processes. The carboxylic acid group imparts acidic properties, allowing for potential interactions with bases and nucleophiles. Additionally, the cyclopropane ring introduces strain, which can enhance reactivity compared to more stable cyclic structures. The compound's molecular structure suggests it may exhibit interesting biological activities, although specific studies would be necessary to elucidate its pharmacological properties. Overall, 1-benzoylcyclopropanecarboxylic acid is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₁₁H₁₀O₃

InChI: InChI=1S/C11H10O3/c12-9(8-4-2-1-3-5-8)11(6-7-11)10(13)14/h1-5H,6-7H2,(H,13,14)

InChI key: InChIKey=RPRZRJABAKWWSK-UHFFFAOYSA-N

SMILES: C(=O)(C1(C(O)=O)CC1)C2=CC=CC=C2

Synonyms:

• 1-(Phenylcarbonyl)cyclopropanecarboxylic acid
• 1-Benzoylcyclopropanecarboxylic acid
• Cyclopropanecarboxylic acid, 1-benzoyl-
• 1-Benzoylcyclopropane-1-carboxylic acid

1-Benzoylcyclopropane-1-carboxylic acid

CAS: 79172-43-3

The 1-benzoylcyclopropane-1-carboxylic acid is a chiral molecule with two stereoisomers. It is a substrate for the enzyme mediated and has been shown to yield the desired product in high yields.

Formula: C₁₁H₁₀O₃

Purity: Min. 95%

Molecular weight: 190.19 g/mol

Ref: 3D-EDA17243