CAS 79185-75-4
:7-hydroxy aristolochic acid A
Description:
7-Hydroxy aristolochic acid A is a naturally occurring compound derived from plants in the Aristolochiaceae family, particularly known for its presence in Aristolochia species. This compound is characterized by its phenolic structure, which contributes to its biological activity. It exhibits significant pharmacological properties, including potential anti-inflammatory and anticancer effects, although it is also associated with nephrotoxicity and carcinogenicity, primarily due to its ability to form DNA adducts. The compound's chemical structure includes a hydroxyl group at the 7-position, which differentiates it from other aristolochic acids. Its solubility can vary depending on the solvent, and it is typically studied in the context of herbal medicine and toxicology. Given its biological implications, 7-hydroxy aristolochic acid A has garnered attention in research focused on the safety and efficacy of herbal remedies containing Aristolochia species. Caution is advised when considering its use due to the potential health risks associated with aristolochic acid derivatives.
Formula:C17H11NO8
InChI:InChI=1/C17H11NO8/c1-24-15-8-4-10(18(22)23)13-9(17(20)21)5-12-16(26-6-25-12)14(13)7(8)2-3-11(15)19/h2-5,19H,6H2,1H3,(H,20,21)
SMILES:COc1c2cc(c3c(cc4c(c3c2ccc1O)OCO4)C(=O)O)N(=O)=O
Synonyms:- 9-Hydroxy-8-methoxy-6-nitrophenanthro[3,4-d][1,3]dioxole-5-carboxylic acid
- Phenanthro[3,4-D]-1,3-Dioxole-5-Carboxylic Acid, 9-Hydroxy-8-Methoxy-6-Nitro-
- 7-Hydroxyaristolochic Acid A
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Phenanthro[3,4-d]-1,3-dioxole-5-carboxylicacid, 9-hydroxy-8-methoxy-6-nitro-
CAS:Formula:C17H11NO8Purity:98%Color and Shape:SolidMolecular weight:357.27117-Hydroxyaristolochic acid A
CAS:7-Hydroxyaristolochic acid A is nephrotoxic and carcinogenic, inhibits APE1/Nrf2/HO-1 axis-induced, and induces apoptosis in NRK-52E cells via COX-2 and PGE2.Formula:C17H11NO8Purity:99.47%Color and Shape:SolidMolecular weight:357.277-Hydroxyaristolochic acid A
CAS:Formula:C17H11NO8Purity:95%~99%Color and Shape:PowderMolecular weight:357.2747-hydroxyaristolochic acid i
CAS:Carboxylic acid with additional oxygen functionsFormula:C17H11NO8Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:357.28




