CymitQuimica logo

CAS 79199-56-7

:

(2R,2′R,3S,3′R,4S)-2′-(3,4-Dihydroxyphenyl)-3,3′,4,4′-tetrahydro-2-(3,4,5-trihydroxyphenyl)[4,8′-bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol

Description:
The chemical substance with the name "(2R,2′R,3S,3′R,4S)-2′-(3,4-Dihydroxyphenyl)-3,3′,4,4′-tetrahydro-2-(3,4,5-trihydroxyphenyl)[4,8′-bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol" and CAS number "79199-56-7" is a complex polyphenolic compound. It is characterized by multiple hydroxyl groups, which contribute to its potential antioxidant properties. The presence of multiple chiral centers indicates that the compound can exist in various stereoisomeric forms, influencing its biological activity and interactions. This substance is likely to exhibit solubility in polar solvents due to its hydroxyl groups, and it may participate in hydrogen bonding, enhancing its reactivity. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds with health benefits, such as anti-inflammatory or anticancer properties. Additionally, the compound's intricate structure may allow for specific interactions with biological targets, making it a subject of interest in medicinal chemistry and natural product research.
Formula:C30H26O13
InChI:InChI=1S/C30H26O13/c31-12-6-17(35)23-22(7-12)42-29(11-4-19(37)26(40)20(38)5-11)27(41)25(23)24-18(36)9-15(33)13-8-21(39)28(43-30(13)24)10-1-2-14(32)16(34)3-10/h1-7,9,21,25,27-29,31-41H,8H2/t21-,25+,27+,28-,29-/m1/s1
InChI key:InChIKey=ZYDDITZPGFXQSD-QKFRQTJPSA-N
SMILES:OC=1C(=C2C(C[C@@H](O)[C@H](O2)C3=CC(O)=C(O)C=C3)=C(O)C1)[C@@H]4C=5C(O[C@@H]([C@H]4O)C6=CC(O)=C(O)C(O)=C6)=CC(O)=CC5O
Synonyms:
  • (2R,2′R,3S,3′R,4S)-2′-(3,4-Dihydroxyphenyl)-3,3′,4,4′-tetrahydro-2-(3,4,5-trihydroxyphenyl)[4,8′-bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol
  • [4,8′-Bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol, 2′-(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-2-(3,4,5-trihydroxyphenyl)-, [2R-[2α,3β,4α(2′R*,3′R*)]]-
  • [4,8′-Bi-2H-1-benzopyran]-3,3′,5,5′,7,7′-hexol, 2′-(3,4-dihydroxyphenyl)-3,3′,4,4′-tetrahydro-2-(3,4,5-trihydroxyphenyl)-, (2R,2′R,3S,3′R,4S)-
  • [Synonyms]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.