CAS 79199-63-6
:(2S,4S)-4-Methylpiperidine-2-carboxylic acid
Description:
(2S,4S)-4-Methylpiperidine-2-carboxylic acid is a chiral compound characterized by its piperidine ring structure, which includes a carboxylic acid functional group and a methyl substituent at the fourth position. This compound is notable for its stereochemistry, specifically the (2S,4S) configuration, which influences its biological activity and interactions. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and organic synthesis, often serving as a building block for the development of pharmaceuticals. Its properties, including melting point, boiling point, and reactivity, can vary based on the specific conditions and purity of the sample. Additionally, due to its chirality, it may exhibit different pharmacological effects compared to its enantiomers, making it significant in the study of stereochemistry in drug design.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-5-2-3-8-6(4-5)7(9)10/h5-6,8H,2-4H2,1H3,(H,9,10)/t5-,6-/m0/s1
InChI key:InChIKey=UQHCHLWYGMSPJC-WDSKDSINSA-N
SMILES:C(O)(=O)[C@@H]1C[C@@H](C)CCN1
Synonyms:- (2S,4S)-4-Methylpiperidine-2-carboxylic acid
- 2-Piperidinecarboxylic acid, 4-methyl-, (2S-trans)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
