CAS 79201-39-1
:tert-butyl 2-cyclopentylidenehydrazinecarboxylate
Description:
Tert-butyl 2-cyclopentylidenehydrazinecarboxylate is an organic compound characterized by its unique structure, which includes a tert-butyl group, a cyclopentylidene moiety, and a hydrazinecarboxylate functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis, particularly in the formation of hydrazones and other nitrogen-containing compounds. The presence of the hydrazine functional group suggests reactivity towards electrophiles, making it useful in various chemical transformations. Additionally, the tert-butyl group contributes to the compound's steric bulk, which can influence its reactivity and solubility in different solvents. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, tert-butyl 2-cyclopentylidenehydrazinecarboxylate is a versatile compound in the realm of synthetic organic chemistry.
Formula:C10H18N2O2
InChI:InChI=1/C10H18N2O2/c1-10(2,3)14-9(13)12-11-8-6-4-5-7-8/h4-7H2,1-3H3,(H,12,13)
SMILES:CC(C)(C)OC(=NN=C1CCCC1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
tert-Butyl 2-cyclopentylidenehydrazinecarboxylate
CAS:Formula:C10H18N2O2Purity:95%Molecular weight:198.2621tert-Butyl 2-cyclopentylidenehydrazinecarboxylate
CAS:tert-Butyl 2-cyclopentylidenehydrazinecarboxylatePurity:95%Molecular weight:198.26g/molTert-Butyl 2-cyclopentylidenehydrazinecarboxylate
CAS:Purity:95.0%Molecular weight:198.26600646972656tert-Butyl 2-cyclopentylidenehydrazinecarboxylate
CAS:<p>tert-Butyl 2-cyclopentylidenehydrazinecarboxylate is a molecule that has been modified to be an agonist for the human liver. It has a profile of pharmacokinetic and molecular target similar to that of endogenous tyrosine kinase ligands, which are peptides and proteins involved in the regulation of metabolism, growth, and development. The pharmacokinetic profile of tert-Butyl 2-cyclopentylidenehydrazinecarboxylate can be optimized through structural modifications such as changes in hydrophobicity or lipophilicity. This optimization can increase its potency as a receptor agonist and lead to better treatment options for diseases such as type II diabetes.</p>Formula:C10H18N2O2Purity:Min. 95%Molecular weight:198.26 g/molRef: 3D-EDA20139
Discontinued product



