CAS 79206-22-7
:(3R,4R)-1-dodecyl-2-(hydroxymethyl)piperidine-3,4,5-triol
Description:
The chemical substance known as (3R,4R)-1-dodecyl-2-(hydroxymethyl)piperidine-3,4,5-triol, with the CAS number 79206-22-7, is a piperidine derivative characterized by its long aliphatic dodecyl chain and multiple hydroxymethyl and hydroxyl functional groups. This compound features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and the presence of three hydroxyl groups contributes to its potential as a polyol. The stereochemistry indicated by the (3R,4R) configuration suggests specific spatial arrangements of the substituents, which can influence the compound's biological activity and solubility. The dodecyl chain enhances its hydrophobic characteristics, making it more soluble in organic solvents while potentially limiting its solubility in water. Such compounds are often studied for their surfactant properties, potential applications in drug delivery systems, and interactions with biological membranes. Overall, the unique structure of this compound may lead to interesting properties and applications in various fields, including medicinal chemistry and materials science.
Formula:C18H37NO4·ClH
InChI:InChI=1/C18H37NO4/c1-2-3-4-5-6-7-8-9-10-11-12-19-13-16(21)18(23)17(22)15(19)14-20/h15-18,20-23H,2-14H2,1H3/t15?,16?,17-,18-/m1/s1
SMILES:CCCCCCCCCCCCN1CC([C@H]([C@@H](C1CO)O)O)O
Synonyms:- N-Dodecyl-1-deoxynojirimycin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Dodecyldeoxynojirimycin
CAS:Controlled ProductApplications Affects trimming glucosidases to a lesser degree than Deoxynojirimycin or N-Methyl- deoxynojirimycin.
References Cox, T., et al.: Lancet, 355, 1481 (2000), Schueler, U., et al.: J. Inherit. Metab. Dis., 27, 649 (2004), Tropak, M., et al.: J. Biol. Chem., 279, 13478 (2004),Formula:C18H37NO4·ClHColor and Shape:NeatMolecular weight:367.95N-Dodecyldeoxynojirimycin
CAS:Dodecyldeoxynojirimycin is a polyketide natural product that has been shown to be a potent inhibitor of the synthesis of mannose-containing glycoproteins, including glucans and chitooligosaccharides. It binds to the active site of glucan synthetase and prevents the formation of glucose residues, which blocks glucan biosynthesis. Dodecyldeoxynojirimycin has also been shown to have anti-inflammatory properties.
Formula:C18H37NO4Purity:Min. 95 Area-%Color and Shape:White PowderMolecular weight:331.49 g/mol


