CAS 79206-95-4

Thiomorpholine, 4-[1-(phenylmethyl)-4-piperidinyl]-, 1,1-dioxide

Description:

Thiomorpholine, 4-[1-(phenylmethyl)-4-piperidinyl]-, 1,1-dioxide, commonly referred to by its CAS number 79206-95-4, is a chemical compound characterized by its unique structure that includes a thiomorpholine ring and a piperidine moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its nitrogen-containing rings. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where such compounds may serve as potential drug candidates. The presence of the thiomorpholine and piperidine groups suggests that it may interact with various biological targets, potentially influencing neurotransmitter systems or other physiological pathways. Additionally, the compound's 1,1-dioxide functional group may contribute to its stability and reactivity. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, this compound represents a class of substances that are of interest in both synthetic and medicinal chemistry.

Formula: C₁₆H₂₄N₂O₂S

InChI: InChI=1S/C16H24N2O2S/c19-21(20)12-10-18(11-13-21)16-6-8-17(9-7-16)14-15-4-2-1-3-5-15/h1-5,16H,6-14H2

InChI key: InChIKey=PAOJEKWHCUMWOP-UHFFFAOYSA-N

SMILES: O=S1(=O)CCN(CC1)C2CCN(CC3=CC=CC=C3)CC2

Synonyms:

• Thiomorpholine, 4-[1-(phenylmethyl)-4-piperidinyl]-, 1,1-dioxide