CAS 79208-64-3
:1-methyl-1,2-dihydro-3H-pyrazole-3-thione
Description:
1-Methyl-1,2-dihydro-3H-pyrazole-3-thione, with the CAS number 79208-64-3, is a heterocyclic compound featuring a pyrazole ring, which is a five-membered ring containing two nitrogen atoms. This compound is characterized by the presence of a thione functional group, which is a sulfur-containing analogue of a ketone, where a sulfur atom replaces the oxygen atom. The methyl group attached to the nitrogen enhances its lipophilicity and can influence its reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and agricultural applications. The thione functionality can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Additionally, the compound's stability, reactivity, and potential applications can be influenced by the presence of substituents on the pyrazole ring. Overall, 1-methyl-1,2-dihydro-3H-pyrazole-3-thione represents a versatile structure in organic synthesis and pharmacology.
Formula:C4H6N2S
InChI:InChI=1/C4H6N2S/c1-6-3-2-4(7)5-6/h2-3H,1H3,(H,5,7)
SMILES:Cn1ccc(n1)S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.