CAS 79211-10-2
:Iosimide
Description:
Iosimide, with the CAS number 79211-10-2, is a chemical compound that belongs to the class of imides. It is characterized by its unique molecular structure, which typically includes a cyclic imide functional group. Iosimide is known for its potential applications in various fields, including pharmaceuticals and materials science. The compound exhibits properties such as stability under certain conditions, and it may have specific solubility characteristics depending on the solvent used. Additionally, like many imides, iosimide may participate in various chemical reactions, including hydrolysis and nucleophilic attack, which can be relevant in synthetic organic chemistry. Safety data and handling precautions are essential when working with this compound, as it may pose health risks if not managed properly. Overall, iosimide represents a class of compounds with diverse applications and interesting chemical behavior, making it a subject of interest in both research and industrial contexts.
Formula:C21H30I3N3O9
InChI:InChI=1S/C21H30I3N3O9/c22-16-13(19(34)25(1-7-28)2-8-29)17(23)15(21(36)27(5-11-32)6-12-33)18(24)14(16)20(35)26(3-9-30)4-10-31/h28-33H,1-12H2
InChI key:InChIKey=KZYHGCLDUQBASN-UHFFFAOYSA-N
SMILES:C(N(CCO)CCO)(=O)C1=C(I)C(C(N(CCO)CCO)=O)=C(I)C(C(N(CCO)CCO)=O)=C1I
Synonyms:- Iosimide
- 1,3,5-Benzenetricarboxamide, N,N,N′,N′,N′′,N′′-hexakis(2-hydroxyethyl)-2,4,6-triiodo-
- SHL 436F
- 1,3,5-Benzenetricarboxamide, N1,N1,N3,N3,N5,N5-hexakis(2-hydroxyethyl)-2,4,6-triiodo-
- N1,N1,N3,N3,N5,N5-Hexakis(2-hydroxyethyl)-2,4,6-triiodo-1,3,5-benzenetricarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
iosimide
CAS:<p>iosimide is a novel nonionic monomer contrast agent that can induce MV in cells.</p>Formula:C21H30I3N3O9Color and Shape:SolidMolecular weight:849.19
