CymitQuimica logo

CAS 79213-74-4

:

Methyl N-[6-(chlorosulfonyl)-1H-benzimidazol-2-yl]carbamate

Description:
Methyl N-[6-(chlorosulfonyl)-1H-benzimidazol-2-yl]carbamate, with the CAS number 79213-74-4, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety substituted with a chlorosulfonyl group and a carbamate functional group. This compound typically exhibits properties associated with both the benzimidazole and sulfonyl functional groups, such as potential biological activity and reactivity. It is often studied for its applications in pharmaceuticals, particularly as a potential therapeutic agent due to its ability to interact with biological targets. The presence of the chlorosulfonyl group may impart unique reactivity, making it useful in synthetic chemistry for further derivatization. Additionally, the methyl carbamate portion can influence solubility and stability in various solvents. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, this compound represents a significant interest in medicinal chemistry and material science.
Formula:C9H8ClN3O4S
InChI:InChI=1S/C9H8ClN3O4S/c1-17-9(14)13-8-11-6-3-2-5(18(10,15)16)4-7(6)12-8/h2-4H,1H3,(H2,11,12,13,14)
InChI key:InChIKey=FPAKSOQSBLHGDU-UHFFFAOYSA-N
SMILES:N(C(OC)=O)C=1NC=2C(N1)=CC=C(S(Cl)(=O)=O)C2
Synonyms:
  • Methyl N-[6-(chlorosulfonyl)-1H-benzimidazol-2-yl]carbamate
  • Methyl [5-(chlorosulfonyl)-1H-benzimidazol-2-yl]carbamate
  • Carbamic acid, N-[6-(chlorosulfonyl)-1H-benzimidazol-2-yl]-, methyl ester
  • Carbamic acid, [5-(chlorosulfonyl)-1H-benzimidazol-2-yl]-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.