CAS 79217-60-0
:Cyclosporin
Description:
Cyclosporin, also known as cyclosporine A, is a cyclic polypeptide composed of 11 amino acids and is primarily known for its immunosuppressive properties. It is produced by the fungus Tolypocladium inflatum and is widely used in clinical settings, particularly in organ transplantation and autoimmune diseases, to prevent organ rejection and manage conditions like rheumatoid arthritis and psoriasis. Cyclosporin functions by inhibiting the activity of T-lymphocytes, thereby suppressing the immune response. It is lipophilic, which affects its absorption and distribution in the body, and it is typically administered orally or intravenously. The drug is metabolized primarily in the liver by cytochrome P450 enzymes, leading to significant drug interactions. Common side effects include nephrotoxicity, hypertension, and increased risk of infections. Due to its narrow therapeutic index, careful monitoring of blood levels is essential to ensure efficacy while minimizing toxicity. Overall, cyclosporin remains a critical therapeutic agent in modern medicine, particularly in transplant immunology.
Formula:Unspecified
InChI:InChI=1/C62H111N11O12/c1-25-27-28-40(15)52(75)51-56(79)65-43(26-2)58(81)67(18)33-48(74)68(19)44(29-34(3)4)55(78)66-49(38(11)12)61(84)69(20)45(30-35(5)6)54(77)63-41(16)53(76)64-42(17)57(80)70(21)46(31-36(7)8)59(82)71(22)47(32-37(9)10)60(83)72(23)50(39(13)14)62(85)73(51)24/h25,27,34-47,49-52,75H,26,28-33H2,1-24H3,(H,63,77)(H,64,76)(H,65,79)(H,66,78)/b27-25+/t40-,41+,42-,43+,44+,45+,46+,47+,49+,50+,51+,52-/m1/s1
Synonyms:- (3S,6S,9S,12R,15S,18S,21S,24S,30S,33S)-30-ethyl-33-[(1R,2R,4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-3,21-bis(1-methylethyl)-6,9,18,24-tetrakis(2-methylpropyl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
- 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-3,21-bis(1-methylethyl)-6,9,18,24-tetrakis(2-methylpropyl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontane-2,5,8,11,14,17,20,23,26,29,32-undecone
- Antibiotic S 7481F1
- Cyclosporin
- Cyclosporina
- Cyclosporine
- Cyclosporins
- Restasis
- cyclosporin A
- MeSH ID: D003524
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cyclosporine
CAS:Cyclosporine is a calcineurin phosphatase pathway inhibitor, used as an immunosuppressant drug to prevent rejection in organ transplantation.Formula:C62H111N11O12Purity:99.68%Color and Shape:White PowderMolecular weight:1202.61Cyclosporine
CAS:Cyclosporine is a drug that belongs to the group of non-steroidal anti-inflammatory drugs. It is used as an immunosuppressant, most commonly in organ transplantations. Cyclosporine has been shown to bind to human MDR1 and inhibit its activity. This binding prevents the efflux of cyclosporin from cells, thereby increasing its concentration in tissues, which leads to the suppression of immune responses. Cyclosporine has also been shown to have a protective effect on ischemic preconditioning, which occurs when a cell is briefly deprived of oxygen and then given an increased level of oxygen. This effect may be due to cyclosporine's ability to inhibit toll-like receptor 4 (TLR4) signaling, which can lead to inflammation and tissue injury. Cyclosporin binds with high specificity and affinity to DNA at the CpG sites found in promoters of genes such as interleukin 2 (IL2), ILFormula:C62H111N11O12Purity:Min. 98 Area-%Color and Shape:White To Off-White SolidMolecular weight:1,202.61 g/mol


