CAS 79218-87-4
:Methyl 3,4-Di-O-benzyl-a-D-mannopyranoside
Description:
Methyl 3,4-Di-O-benzyl-α-D-mannopyranoside is a glycoside derived from mannose, characterized by the presence of two benzyl groups attached to the 3 and 4 positions of the sugar ring, along with a methoxy group at the anomeric carbon. This compound is typically a white to off-white solid and is soluble in organic solvents such as methanol and dichloromethane, but less soluble in water due to its hydrophobic benzyl substituents. It exhibits properties typical of glycosides, including potential reactivity in glycosylation reactions, making it useful in synthetic organic chemistry and carbohydrate chemistry. The presence of the benzyl groups can enhance its stability and alter its reactivity compared to other mannopyranosides. Additionally, this compound may exhibit biological activity, as many glycosides are known for their roles in biological systems and potential therapeutic applications. Proper handling and storage conditions should be observed due to its chemical nature and potential reactivity.
Formula:C21H26O6
InChI:InChI=1/C21H26O6/c1-24-21-18(23)20(26-14-16-10-6-3-7-11-16)19(17(12-22)27-21)25-13-15-8-4-2-5-9-15/h2-11,17-23H,12-14H2,1H3/t17-,18+,19-,20-,21+/m1/s1
Synonyms:- methyl 3,4-di-O-benzyl-alpha-D-mannopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3,4-di-O-benzyl-a-D-mannopyranoside
CAS:<p>Methyl 3,4-di-O-benzyl-a-D-mannopyranoside is a synthetic compound that belongs to the class of oligosaccharides. It is a sugar that has a complex carbohydrate structure with a glycosylated and methylated sugar. The compound is custom synthesized and is used as a reagent in glycosylation reactions. Methyl 3,4-di-O-benzyl-a-D-mannopyranoside can be used for click modification of proteins, polypeptides, and carbohydrates.</p>Formula:C21H26O6Purity:Min. 95%Molecular weight:374.43 g/mol

