CymitQuimica logo

CAS 792180-52-0

:

5-bromo-2-(4-piperidyloxy)pyrimidine

Description:
5-Bromo-2-(4-piperidyloxy)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 5-position introduces a halogen substituent, which can influence the compound's reactivity and biological activity. The 2-position features a piperidyloxy group, which consists of a piperidine ring (a six-membered saturated nitrogen-containing ring) attached to an oxygen atom. This functional group can enhance the compound's solubility and potential interactions with biological targets. The compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where modifications to the pyrimidine structure can lead to compounds with varying biological activities. Its molecular structure suggests potential applications in drug development, particularly in areas related to neurological or psychiatric disorders, given the presence of the piperidine moiety. As with many heterocyclic compounds, its synthesis and characterization are crucial for understanding its properties and potential uses.
Formula:C9H12BrN3O
InChI:InChI=1/C9H12BrN3O/c10-7-5-12-9(13-6-7)14-8-1-3-11-4-2-8/h5-6,8,11H,1-4H2
SMILES:C1CNCCC1Oc1ncc(cn1)Br
Synonyms:
  • 5-Bromo-2-(piperidin-4-yloxy)pyrimidine
  • Pyrimidine, 5-Bromo-2-(4-Piperidinyloxy)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.