CymitQuimica logo

CAS 792182-08-2

:

1-(2,3-dihydro-1H-inden-5-yloxy)-3-[(1-methylpropyl)amino]propan-2-ol

Description:
1-(2,3-dihydro-1H-inden-5-yloxy)-3-[(1-methylpropyl)amino]propan-2-ol, with the CAS number 792182-08-2, is a chemical compound that belongs to the class of beta-adrenergic receptor agonists. This substance features a complex molecular structure characterized by an indene moiety, which contributes to its unique pharmacological properties. It typically exhibits moderate to high lipophilicity, influencing its absorption and distribution in biological systems. The presence of the propanolamine group suggests potential interactions with adrenergic receptors, which may lead to effects on cardiovascular and respiratory systems. Additionally, the compound may demonstrate selectivity for specific receptor subtypes, impacting its therapeutic applications. Its solubility profile and stability under various conditions are essential for formulation in pharmaceutical contexts. As with many compounds in this class, understanding its pharmacokinetics, mechanism of action, and potential side effects is crucial for evaluating its efficacy and safety in clinical use.
Formula:C16H25NO2
InChI:InChI=1/C16H25NO2/c1-3-12(2)17-10-15(18)11-19-16-8-7-13-5-4-6-14(13)9-16/h7-9,12,15,17-18H,3-6,10-11H2,1-2H3
SMILES:CCC(C)NCC(COc1ccc2CCCc2c1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.