
CAS 79232-88-5
:6-Chloro-N-(4-methylphenyl)-3-pyridazinamine
Description:
6-Chloro-N-(4-methylphenyl)-3-pyridazinamine, with the CAS number 79232-88-5, is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 6-position and a 4-methylphenyl group at the nitrogen atom contributes to its unique chemical properties. This compound is typically classified as an aromatic amine due to the amine functional group attached to the pyridazine ring. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Safety and handling precautions are essential when working with this substance, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C11H10ClN3
InChI:InChI=1S/C11H10ClN3/c1-8-2-4-9(5-3-8)13-11-7-6-10(12)14-15-11/h2-7H,1H3,(H,13,15)
InChI key:InChIKey=YDFIBZRYTAEYMQ-UHFFFAOYSA-N
SMILES:N(C1=CC=C(C)C=C1)C2=CC=C(Cl)N=N2
Synonyms:- 3-Pyridazinamine, 6-chloro-N-(4-methylphenyl)-
- Pyridazine, 3-chloro-6-p-toluidino-
- (6-Chloro-pyridazin-3-yl)-p-tolyl-amine
- 6-Chloro-N-(4-methylphenyl)-3-pyridazinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.