CAS 79234-80-3
:1-hydroxysulfurmycin A
Description:
1-Hydroxysulfurmycin A is a naturally occurring compound classified as a sulfur-containing antibiotic. It is derived from the fermentation of certain bacterial strains, particularly those in the genus *Streptomyces*. This compound exhibits notable antibacterial properties, making it of interest in agricultural and pharmaceutical applications. Structurally, it features a hydroxyl group and a sulfur atom, contributing to its biological activity. The presence of these functional groups allows for interactions with bacterial enzymes and cellular processes, inhibiting growth and proliferation of susceptible microorganisms. Additionally, 1-hydroxysulfurmycin A has been studied for its potential use in crop protection, as it can effectively combat plant pathogens. Its mode of action typically involves disrupting essential metabolic pathways in bacteria, leading to cell death. As with many antibiotics, the development of resistance is a concern, prompting ongoing research into its efficacy and mechanisms. Overall, 1-hydroxysulfurmycin A represents a significant compound in the field of microbiology and agricultural science.
Formula:C43H53NO17
InChI:InChI=1/C43H53NO17/c1-17(45)15-43(54)16-28(32-21(36(43)42(53)55-7)12-22-33(38(32)51)39(52)35-26(48)9-8-25(47)34(35)37(22)50)59-30-13-23(44(5)6)40(19(3)57-30)61-31-14-27(49)41(20(4)58-31)60-29-11-10-24(46)18(2)56-29/h8-9,12,18-20,23,27-31,36,40-41,47-49,51,54H,10-11,13-16H2,1-7H3
Synonyms:- 1-hydroxysulfurmycin A
- 1-Hydroxysulfurmycin
- 1-Naphthacenecarboxylic acid, 1,2,3,4,6,11-hexahydro-2,5,7,10-tetrahydroxy-6,11-dioxo-2-(2-oxopropyl)-4-[[2,3,6-trideoxy-4-O-[2,6-dideoxy-4-O-[(2R-trans)-tetrahydro-6-methyl-5-oxo-2H-pyran-2-yl]-α-L-lyxo-hexopyranosyl]-3-(dimethylamino)-α-L-lyxo-hexopyranosyl]oxy]-, methyl ester, [1R-(1α,2β,4β)]- (9...
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Hydroxysulfurmycin A
CAS:1-Hydroxysulfurmycin A is an anthracycline antibiotic with activity against Gram-positive bacteria and tumor cells.Formula:C43H53NO17Color and Shape:SolidMolecular weight:855.877
