CAS 79258-14-3
:(8R,13S,16R)-2,4-dibromo-3,16-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
Description:
The chemical substance with the name "(8R,13S,16R)-2,4-dibromo-3,16-dihydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one" and CAS number "79258-14-3" is a complex organic compound characterized by its multi-ring structure, which includes a cyclopenta[a]phenanthrene framework. This compound features multiple functional groups, including two bromine atoms and two hydroxyl groups, which contribute to its reactivity and potential biological activity. The presence of these substituents can influence its solubility, stability, and interaction with biological systems. The stereochemistry indicated by the specific R and S configurations at various carbon centers suggests that the compound may exhibit chirality, potentially leading to different biological effects depending on the enantiomer. Such compounds are often of interest in medicinal chemistry and pharmacology due to their structural complexity and potential therapeutic applications. Further studies would be necessary to elucidate its specific properties, biological activities, and potential uses in various fields.
Formula:C18H20Br2O3
InChI:InChI=1/C18H20Br2O3/c1-18-5-4-8-9(12(18)7-14(21)17(18)23)2-3-10-11(8)6-13(19)16(22)15(10)20/h6,8-9,12,14,21-22H,2-5,7H2,1H3/t8?,9-,12?,14-,18+/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
