CymitQuimica logo

CAS 79265-36-4

:

Trimethylsilylthiazole; 98%

Description:
Trimethylsilylthiazole is an organosilicon compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The compound features three methyl groups attached to a silicon atom, contributing to its trimethylsilyl functional group. This structure enhances its stability and solubility in organic solvents, making it useful in various chemical applications. Trimethylsilylthiazole is often utilized as a reagent in organic synthesis, particularly in the preparation of thiazole derivatives and other heterocyclic compounds. Its reactivity is influenced by the presence of the thiazole ring, which can participate in nucleophilic and electrophilic reactions. Additionally, the trimethylsilyl group can serve as a protecting group for alcohols and amines during synthetic processes. The compound is typically handled with care, as it may pose health hazards if inhaled or ingested. Proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C6H11NSSi
InChI:InChI=1/C6H11NSSi/c1-9(2,3)6-4-7-5-8-6/h4-5H,1-3H3
InChI key:BFCGWRVEKWHDGG-UHFFFAOYSA-N
SMILES:C[Si](C)(C)c1cncs1
Synonyms:
  • 5-Trimethylsilylthiazole
  • 5-(Trimethylsilyl)-1,3-Thiazole
Found 5 products.