CAS 79288-94-1

Azure B tetrafluoroborate

Description:

Azure B tetrafluoroborate is a chemical compound that consists of the Azure B dye cation paired with a tetrafluoroborate anion. Azure B itself is a synthetic dye belonging to the phenothiazine family, characterized by its vibrant blue color, which is often used in biological staining and as a pH indicator. The tetrafluoroborate anion (BF4-) is a stable, non-coordinating anion that enhances the solubility of the dye in various solvents. Azure B tetrafluoroborate is typically soluble in polar organic solvents, making it useful in various applications, including analytical chemistry and dyeing processes. The compound exhibits distinct optical properties, which are exploited in fluorescence microscopy and other imaging techniques. Additionally, its stability and solubility profile make it a valuable reagent in organic synthesis and research. Safety precautions should be observed when handling this compound, as with many synthetic dyes, due to potential toxicity and environmental concerns.

Formula: C₁₅H₁₆N₃S·BF₄

InChI: InChI=1S/C15H16N3S.BF4/c1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12;2-1(3,4)5/h4-9,16H,1-3H3;/q+1;-1

InChI key: InChIKey=POGWSMCKHBUZDE-UHFFFAOYSA-N

SMILES: N(C)(C)C1=CC2=C(N=C3C(=[S+]2)C=C(NC)C=C3)C=C1.[B+3]([F-])([F-])([F-])[F-]

Synonyms:

• AzurBtetrafluoroborate
• Azure B tetrafluoroborate
• Borate(1-), tetrafluoro-, 3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium
• N-methyl-N-[7-(methylamino)-3H-phenothiazin-3-ylidene]methanaminium tetrafluoroborate
• Phenothiazin-5-ium, 3-(dimethylamino)-7-(methylamino)-, tetrafluoroborate(1-)
• Phenothiazin-5-ium, 3-(dimethylamino)-7-(methylamino)-, tetrafluoroborate(1-) (1:1)

Azure B tetrafluoroborate

CAS: 79288-94-1

Formula: C₁₅H₁₆BF₄N₃S

Purity: 95%

Molecular weight: 357.1773

Ref: IN-DA003NYE

Azure B Tetrafluoroborate

CAS: 79288-94-1

Azure B Tetrafluoroborate

Purity: 97%

Molecular weight: 357.18g/mol

Ref: 54-PC108788

Azure B tetrafluoroborate

CAS: 79288-94-1

Formula: C₁₅H₁₆BF₄N₃S

Molecular weight: 357.18

Ref: 7W-GT9777

Azure B Tetrafluoroborate

CAS: 79288-94-1

Azure B Tetrafluoroborate is a potentiator for antibiotics. It is used to enhance the antibacterial efficacy of antibiotics by increasing their ability to penetrate tissues and bacterial biofilms. Azure B Tetrafluoroborate is an organic solvent that can be applied with a handpiece or cavity instrument. It has been shown to increase the in vitro activity of various antibiotics against gram-negative organisms and can be used as a polymeric matrix for coating medical devices such as catheters, endoscopes, and implants. The mechanism of action involves activation of the chemical species within the antibiotic molecule, which then reacts with diode-pumped solid state laser radiation to produce luminescence reactions.

Formula: C₁₅H₁₆N₃S·BF₄

Purity: Min. 95%

Molecular weight: 357.18 g/mol

Ref: 3D-FA78039