
CAS 79289-49-9
:1,2-Diazetidin-3-one, 4-methylbenzenesulfonate (1:1)
Description:
1,2-Diazetidin-3-one, 4-methylbenzenesulfonate (1:1) is a chemical compound characterized by its unique diazetidine structure, which features a five-membered ring containing two nitrogen atoms. This compound is typically used in organic synthesis and may serve as an intermediate in the preparation of various pharmaceuticals or agrochemicals. The presence of the 4-methylbenzenesulfonate moiety contributes to its solubility and reactivity, making it a versatile building block in chemical reactions. The sulfonate group enhances the compound's stability and can facilitate nucleophilic substitution reactions. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and solvents used. Safety data should be consulted, as compounds containing sulfonate groups may exhibit specific hazards. Overall, 1,2-Diazetidin-3-one, 4-methylbenzenesulfonate is an interesting compound in the field of synthetic organic chemistry, with potential applications in various chemical processes.
Formula:C7H8O3S·C2H4N2O
InChI:InChI=1S/C7H8O3S.C2H4N2O/c1-6-2-4-7(5-3-6)11(8,9)10;5-2-1-3-4-2/h2-5H,1H3,(H,8,9,10);3H,1H2,(H,4,5)
InChI key:InChIKey=SASDRDQNJSKFHJ-UHFFFAOYSA-N
SMILES:O=C1CNN1.S(=O)(=O)(O)C1=CC=C(C)C=C1
Synonyms:- 1,2-Diazetidin-3-one, 4-methylbenzenesulfonate (1:1)
- 1,2-Diazetidin-3-one, mono(4-methylbenzenesulfonate)
- 3-Oxo-1,2-diazetidinium tosylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,2-Diazetidin-3-one, 4-methylbenzene-1-sulfonic acid
CAS:Metformin is a pharmaceutical agent that is used to treat type 2 diabetes and metabolic syndrome. Metformin inhibits the enzyme gluconeogenic dehydrogenase, which leads to a decrease in blood glucose levels. It also reduces insulin resistance and dyslipidemia by inhibiting the release of insulin from pancreatic beta cells. Metformin has been shown to be prophylactic for diabetic patients with cardiovascular disease, as it lowers blood pressure and reduces the risk of heart attack or stroke. The solvate form of metformin is more water-soluble than metformin hydrochloride and can be given intravenously.Formula:C9H12N2O4SPurity:Min. 95%Molecular weight:244.3 g/mol
