CymitQuimica logo

CAS 792946-65-7

:

4-(1,3-benzoxazol-2-yl)-2-methylaniline

Description:
4-(1,3-benzoxazol-2-yl)-2-methylaniline, identified by its CAS number 792946-65-7, is an organic compound characterized by its complex structure, which includes a benzoxazole moiety and an aniline group. This substance typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, reflecting its aromatic nature. It may display fluorescence due to the presence of the benzoxazole ring, which is known for its photochemical properties. The compound is likely to participate in various chemical reactions, including electrophilic aromatic substitution, owing to the presence of the amino group. Additionally, it may have applications in fields such as materials science, pharmaceuticals, or as a dye, given the functional groups present. Safety data should be consulted to understand its toxicity and handling requirements, as compounds with similar structures can exhibit varying degrees of biological activity. Overall, 4-(1,3-benzoxazol-2-yl)-2-methylaniline is a compound of interest for further research and application in various chemical contexts.
Formula:C14H12N2O
InChI:InChI=1/C14H12N2O/c1-9-8-10(6-7-11(9)15)14-16-12-4-2-3-5-13(12)17-14/h2-8H,15H2,1H3
SMILES:Cc1cc(ccc1N)c1nc2ccccc2o1
Synonyms:
  • 4-Benzooxazol-2-yl-2-methyl-phenylamine
  • Benzenamine, 4-(2-Benzoxazolyl)-2-Methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.