CAS 792953-01-6

5-Amino-1-(2,6-dichlorophenyl)-1H-pyrazole-4-carbonitrile

Description:

5-Amino-1-(2,6-dichlorophenyl)-1H-pyrazole-4-carbonitrile is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a cyano group, contributing to its reactivity and potential biological activity. The presence of the 2,6-dichlorophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-inflammatory or anticancer activities. The molecular structure suggests that it may participate in hydrogen bonding due to the amino group, while the cyano group can act as an electron-withdrawing substituent, affecting the compound's electronic properties. Additionally, the dichlorophenyl moiety may provide steric hindrance, influencing the compound's binding affinity to specific receptors or enzymes. Overall, 5-Amino-1-(2,6-dichlorophenyl)-1H-pyrazole-4-carbonitrile represents a class of compounds that are of interest in medicinal chemistry and drug development.

Formula: C₁₀H₆Cl₂N₄

InChI: InChI=1S/C10H6Cl2N4/c11-7-2-1-3-8(12)9(7)16-10(14)6(4-13)5-15-16/h1-3,5H,14H2

InChI key: InChIKey=KVARRCNLKYNSJX-UHFFFAOYSA-N

SMILES: ClC1=C(C(Cl)=CC=C1)N2C(N)=C(C#N)C=N2

Synonyms:

• 5-Amino-1-(2,6-dichlorophenyl)-1H-pyrazole-4-carbonitrile
• 1H-Pyrazole-4-carbonitrile, 5-amino-1-(2,6-dichlorophenyl)-

1H-Pyrazole-4-carbonitrile, 5-amino-1-(2,6-dichlorophenyl)-

CAS: 792953-01-6

Formula: C₁₀H₆Cl₂N₄

Purity: 98%

Molecular weight: 253.0874

Ref: IN-DA01SL71

5-Amino-1-(2,6-dichlorophenyl)-1H-pyrazole-4-carbonitrile

CAS: 792953-01-6

5-Amino-1-(2,6-dichlorophenyl)-1H-pyrazole-4-carbonitrile

Purity: 98%

Molecular weight: 253.09g/mol

Ref: 54-OR1063089