
CAS 792953-16-3
:5-Amino-1-(2-methoxyphenyl)-1H-pyrazole-4-carboxamide
Description:
5-Amino-1-(2-methoxyphenyl)-1H-pyrazole-4-carboxamide is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the 2-methoxyphenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The molecular structure suggests that it could participate in hydrogen bonding due to the amino and carboxamide groups, which may be relevant for its solubility and reactivity. Additionally, the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 792953-16-3, allows for precise identification in chemical databases. Overall, this compound's unique structural features position it as a candidate for further research in various applications, including drug development and biochemical studies.
Formula:C11H12N4O2
InChI:InChI=1S/C11H12N4O2/c1-17-9-5-3-2-4-8(9)15-10(12)7(6-14-15)11(13)16/h2-6H,12H2,1H3,(H2,13,16)
InChI key:InChIKey=XDKMHJPXWPWYIJ-UHFFFAOYSA-N
SMILES:NC=1N(N=CC1C(N)=O)C2=C(OC)C=CC=C2
Synonyms:- 5-Amino-1-(2-methoxyphenyl)-1H-pyrazole-4-carboxylic acid amide
- 5-Amino-1-(2-methoxyphenyl)-1H-pyrazole-4-carboxamide
- 1H-Pyrazole-4-carboxamide, 5-amino-1-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.