CAS 792953-75-4

N-[3-(Aminosulfonyl)-4-methoxyphenyl]-2-chloroacetamide

Description:

N-[3-(Aminosulfonyl)-4-methoxyphenyl]-2-chloroacetamide, identified by its CAS number 792953-75-4, is a chemical compound that features a sulfonamide functional group, which is known for its antibacterial properties. The presence of the methoxy group enhances its solubility and potential biological activity. This compound is characterized by its amide linkage, which contributes to its stability and reactivity. The chlorine atom in the 2-position of the acetamide moiety may influence its pharmacological properties, potentially enhancing its interaction with biological targets. Typically, compounds of this nature are investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. The structural features suggest that it may exhibit specific interactions with enzymes or receptors, making it a candidate for further research in drug discovery. As with many sulfonamide derivatives, it may also possess anti-inflammatory or antimicrobial activities, although specific biological activities would need to be confirmed through empirical studies.

Formula: C₉H₁₁ClN₂O₄S

InChI: InChI=1S/C9H11ClN2O4S/c1-16-7-3-2-6(12-9(13)5-10)4-8(7)17(11,14)15/h2-4H,5H2,1H3,(H,12,13)(H2,11,14,15)

InChI key: InChIKey=UTSIXBGWRVEQCK-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(OC)C=CC(NC(CCl)=O)=C1

Synonyms:

• Acetamide, N-[3-(aminosulfonyl)-4-methoxyphenyl]-2-chloro-
• N-[3-(Aminosulfonyl)-4-methoxyphenyl]-2-chloroacetamide