CAS 792953-99-2

5-[(Ethylamino)sulfonyl]-2-methylbenzoic acid

Description:

5-[(Ethylamino)sulfonyl]-2-methylbenzoic acid is an organic compound characterized by its sulfonamide functional group, which contributes to its potential as a pharmaceutical agent. The structure features a benzoic acid moiety substituted with an ethylamino group and a sulfonyl group, enhancing its solubility and reactivity. This compound typically exhibits moderate to high polarity due to the presence of the sulfonamide and carboxylic acid functionalities, which can engage in hydrogen bonding. Its molecular interactions may allow it to participate in various biological processes, making it of interest in medicinal chemistry. The compound's stability is generally influenced by pH and temperature, and it may exhibit specific solubility characteristics in different solvents. Additionally, its potential applications could include roles in drug development, particularly in targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, given the potential for biological activity and reactivity.

Formula: C₁₀H₁₃NO₄S

InChI: InChI=1S/C10H13NO4S/c1-3-11-16(14,15)8-5-4-7(2)9(6-8)10(12)13/h4-6,11H,3H2,1-2H3,(H,12,13)

InChI key: InChIKey=SVJBFKVNUXDLJY-UHFFFAOYSA-N

SMILES: S(NCC)(=O)(=O)C1=CC(C(O)=O)=C(C)C=C1

Synonyms:

• Benzoic acid, 5-[(ethylamino)sulfonyl]-2-methyl-
• 5-[(Ethylamino)sulfonyl]-2-methylbenzoic acid

5-(Ethylsulfamoyl)-2-methylbenzoic acid

CAS: 792953-99-2

5-(Ethylsulfamoyl)-2-methylbenzoic acid

Purity: 95%

Molecular weight: 243.28g/mol

Ref: 54-OR83803

5-(Ethylsulfamoyl)-2-methylbenzoic acid

CAS: 792953-99-2

Purity: 97%

Molecular weight: 243.2799988

Ref: 10-F645052