
CAS 792954-17-7
:2-Chloro-N-[3-[4-(1,1-dimethylethyl)benzoyl]-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-2-yl]acetamide
Description:
2-Chloro-N-[3-[4-(1,1-dimethylethyl)benzoyl]-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-2-yl]acetamide, with CAS number 792954-17-7, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, an acetamide functional group, and a tetrahydrobenzo[b]thien moiety. This compound features a bulky tert-butyl group attached to a benzoyl moiety, contributing to its steric properties. The presence of the chloro substituent enhances its reactivity and potential biological activity. It is likely to exhibit lipophilic characteristics due to the aromatic and aliphatic components in its structure, which may influence its solubility and interaction with biological membranes. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features that could interact with specific biological targets. As with many synthetic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used.
Formula:C22H26ClNO2S
InChI:InChI=1S/C22H26ClNO2S/c1-13-5-10-16-17(11-13)27-21(24-18(25)12-23)19(16)20(26)14-6-8-15(9-7-14)22(2,3)4/h6-9,13H,5,10-12H2,1-4H3,(H,24,25)
InChI key:InChIKey=HVLZPJWVPMKJQE-UHFFFAOYSA-N
SMILES:C(=O)(C=1C2=C(SC1NC(CCl)=O)CC(C)CC2)C3=CC=C(C(C)(C)C)C=C3
Synonyms:- 2-Chloro-N-[3-[4-(1,1-dimethylethyl)benzoyl]-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-2-yl]acetamide
- Acetamide, 2-chloro-N-[3-[4-(1,1-dimethylethyl)benzoyl]-4,5,6,7-tetrahydro-6-methylbenzo[b]thien-2-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.