
CAS 792957-74-5
:ER-000444793
Description:
ER-000444793, with the CAS number 792957-74-5, is a chemical compound that has garnered attention in pharmaceutical research, particularly in the context of its potential therapeutic applications. While specific characteristics such as molecular weight, structure, and solubility may vary, compounds in this category are often evaluated for their biological activity, including their mechanism of action, efficacy, and safety profile. Typically, such compounds may exhibit properties that allow them to interact with specific biological targets, potentially leading to desired pharmacological effects. Researchers often conduct extensive studies to determine the compound's stability, reactivity, and compatibility with other substances. Additionally, the compound's synthesis, purification methods, and analytical techniques for characterization are crucial for understanding its properties and potential applications. As with any chemical substance, safety data sheets (SDS) and regulatory information are essential for handling and usage in laboratory or industrial settings. For detailed and specific information, consulting scientific literature or databases is recommended.
Formula:C23H18N2O2
InChI:InChI=1S/C23H18N2O2/c26-22-15-19(18-11-5-7-13-21(18)24-22)23(27)25-20-12-6-4-10-17(20)14-16-8-2-1-3-9-16/h1-13,15H,14H2,(H,24,26)(H,25,27)
InChI key:OIZPRRGJIHYZAY-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)CC2=CC=CC=C2NC(=O)C3=CC(=O)NC4=CC=CC=C43
Synonyms:- ER-000444793
- 4-Quinolinecarboxamide, 1,2-dihydro-2-oxo-N-[2-(phenylmethyl)phenyl]-
- (ER000444793)
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
ER-000444793
CAS:ER-000444793 is a potent mitochondrial permeability transition pore (mPTP) opening inhibitor and it also inhibits mPTP (IC50: 2.8 μM).Formula:C23H18N2O2Purity:99.55%Color and Shape:White SolidMolecular weight:354.4Ref: TM-T15241
1mg73.00€5mg152.00€1mL*10mM (DMSO)166.00€10mg222.00€25mg442.00€50mg643.00€100mg888.00€500mg1,783.00€N-(2-Benzylphenyl)-2-oxo-1,2-dihydroquinoline-4-carboxamide
CAS:Formula:C23H18N2O2Purity:98%Color and Shape:SolidMolecular weight:354.4012ER-000444793
CAS:N-(2-Benzylphenyl)-2-oxo-1,2-dihydroquinoline-4-carboxamideFormula:C23H18N2O2Purity:98%Molecular weight:354.4N-(2-Benzylphenyl)-2-oxo-1,2-dihydroquinoline-4-carboxamide
CAS:Purity:98%Molecular weight:354.4089966ER-000444793
CAS:ER-000444793 is a drug that belongs to the group of mitochondrial membrane permeabilizations. It has been shown to have an effect on the mitochondrial membrane potential, which can lead to cell death. ER-000444793 has been shown to be effective in cardiac tissue, as well as other tissues such as liver and kidney. The mechanism of action is not fully understood, but it is thought to be mediated by the mitochondrial membrane permeabilization and subsequent release of proapoptotic factors.
Formula:C23H18N2O2Purity:Min. 95%Molecular weight:354.4 g/mol





