CAS 793-54-4
:Gon-4-en-3-one, 13-ethyl-17-hydroxy-, (17β)-(±)-
Description:
Gon-4-en-3-one, 13-ethyl-17-hydroxy-, (17β)-(±)-, commonly known as 17β-estradiol, is a steroid hormone that plays a crucial role in the regulation of various physiological processes, particularly in the female reproductive system. This compound is characterized by its steroid structure, which includes four fused carbon rings and specific functional groups, such as a hydroxyl (-OH) group at the 17th carbon position. The presence of the ethyl group at the 13th position contributes to its unique properties and biological activity. As a hormone, it is involved in the menstrual cycle, reproductive health, and secondary sexual characteristics. The (±) notation indicates that the substance exists as a racemic mixture of enantiomers, which can exhibit different biological activities. In terms of solubility, it is generally lipophilic, allowing it to easily cross cell membranes and interact with estrogen receptors. Its therapeutic applications include hormone replacement therapy and treatment of certain hormone-sensitive conditions.
Formula:C19H28O2
InChI:InChI=1/C19H28O2/c1-2-19-10-9-15-14-6-4-13(20)11-12(14)3-5-16(15)17(19)7-8-18(19)21/h11,14-18,21H,2-10H2,1H3/t14-,15+,16+,17-,18?,19?/m0/s1
InChI key:InChIKey=FBYZQDCRLYHHHP-QBGKEEDBNA-N
SMILES:C(C)[C@@]12[C@]([C@]3([C@](CC1)([C@@]4(C(CC3)=CC(=O)CC4)[H])[H])[H])(CC[C@@H]2O)[H]
Synonyms:- (±)-17β-Hydroxy-13β-ethyl-4-gonen-3-one
- Gon-4-en-3-one, 13-ethyl-17β-hydroxy-, (±)-
- Gon-4-en-3-one, 13-ethyl-17-hydroxy-, (17β)-(±)-
- dl-13β-Ethyl-17β-hydroxygon-4-en-3-one
- Wy 3016
- 13-ethyl-17-hydroxy-gon-4-en-3-one
- (+-)-13-Ethyl-17-hydroxy-gon-4-en-3-on
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

