CAS 793-92-0
:1,3,5-trifluoro-2,4,6-tris(trifluoromethyl)benzene
Description:
1,3,5-Trifluoro-2,4,6-tris(trifluoromethyl)benzene, with the CAS number 793-92-0, is a highly fluorinated aromatic compound characterized by its three trifluoromethyl groups (-CF3) attached to a benzene ring. This structure imparts significant hydrophobicity and lipophobicity, making the compound non-polar and resistant to many solvents. The presence of multiple fluorine atoms enhances its thermal stability and chemical inertness, which can be advantageous in various applications, including as a building block in the synthesis of advanced materials and pharmaceuticals. Additionally, the compound exhibits unique electronic properties due to the electron-withdrawing nature of the trifluoromethyl groups, influencing its reactivity and interactions with other chemical species. Its high electronegativity can also lead to interesting behavior in terms of solubility and volatility. Overall, 1,3,5-trifluoro-2,4,6-tris(trifluoromethyl)benzene is notable for its distinctive physical and chemical properties, making it a subject of interest in both industrial and research contexts.
Formula:C9F12
InChI:InChI=1/C9F12/c10-4-1(7(13,14)15)5(11)3(9(19,20)21)6(12)2(4)8(16,17)18
SMILES:c1(c(c(c(c(c1F)C(F)(F)F)F)C(F)(F)F)F)C(F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.