CAS 79312-42-8

4-Methyl-2-thiazolecarbonyl chloride

Description:

4-Methyl-2-thiazolecarbonyl chloride, with the CAS number 79312-42-8, is a chemical compound characterized by its thiazole ring structure, which incorporates a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can participate in nucleophilic substitution reactions. The thiazole moiety contributes to its potential biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, 4-Methyl-2-thiazolecarbonyl chloride is often used as an intermediate in the synthesis of various organic compounds, including pharmaceuticals and fine chemicals. Safety precautions are necessary when handling this compound, as it may be corrosive and can release toxic gases upon hydrolysis. Proper storage conditions, typically in a cool, dry place away from moisture, are essential to maintain its stability and prevent degradation.

Formula: C₅H₄ClNOS

InChI: InChI=1S/C5H4ClNOS/c1-3-2-9-5(7-3)4(6)8/h2H,1H3

InChI key: InChIKey=SGXFKGABJPKDAK-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C1=NC(C)=CS1

Synonyms:

• 2-Thiazolecarbonyl chloride, 4-methyl-
• 4-Methyl-2-thiazolecarbonyl chloride