
CAS 79324-48-4
:2,8-Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano[3,2-g]quinoline-2,8-dicarboxylate
Description:
2,8-Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano[3,2-g]quinoline-2,8-dicarboxylate is a complex organic compound characterized by its unique pyranoquinoline structure, which incorporates multiple functional groups, including ester and carbonyl moieties. This compound typically exhibits a range of chemical properties, such as solubility in organic solvents, which may vary depending on the specific substituents and their positions on the molecular framework. The presence of dicarboxylate groups suggests potential for forming salts or undergoing esterification reactions. Additionally, the compound may display interesting biological activities, making it a candidate for pharmaceutical applications. Its molecular structure indicates potential for interactions with biological targets, possibly influencing its pharmacokinetic and pharmacodynamic profiles. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 2,8-Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano[3,2-g]quinoline-2,8-dicarboxylate represents a fascinating subject for further research in organic chemistry and medicinal applications.
Formula:C21H21NO7
InChI:InChI=1S/C21H21NO7/c1-4-7-11-18-12(15(23)9-14(22-18)20(25)27-5-2)8-13-16(24)10-17(29-19(11)13)21(26)28-6-3/h8-10H,4-7H2,1-3H3,(H,22,23)
InChI key:InChIKey=DZXIKYRDMDEUMX-UHFFFAOYSA-N
SMILES:C(CC)C1=C2C(=CC3=C1OC(C(OCC)=O)=CC3=O)C(=O)C=C(C(OCC)=O)N2
Synonyms:- 2,8-Diethyl 6,9-dihydro-4,6-dioxo-10-propyl-4H-pyrano[3,2-g]quinoline-2,8-dicarboxylate
- 4H-Pyrano[3,2-g]quinoline-2,8-dicarboxylic acid, 6,9-dihydro-4,6-dioxo-10-propyl-, 2,8-diethyl ester
- 4H-Pyrano[3,2-g]quinoline-2,8-dicarboxylic acid, 6,9-dihydro-4,6-dioxo-10-propyl-, diethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
