CAS 79324-77-9

1-(3-iodo-4-methoxy-phenyl)ethanone

Description:

1-(3-Iodo-4-methoxy-phenyl)ethanone, with the CAS number 79324-77-9, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features an ethanone moiety, indicating the presence of a carbonyl group (C=O) adjacent to an ethyl group. The aromatic ring is substituted with both an iodine atom and a methoxy group (-OCH3), which can influence its reactivity and physical properties. The iodine substitution typically enhances the compound's electrophilicity, making it more reactive in nucleophilic substitution reactions. The methoxy group can also affect the compound's solubility and polarity, often increasing its lipophilicity. In terms of physical properties, compounds of this nature are generally solid at room temperature and may exhibit characteristic UV-Vis absorption due to the presence of the aromatic system. Additionally, the presence of halogens and methoxy groups can influence the compound's biological activity, making it of interest in medicinal chemistry and material science.

Formula: C₉H₉IO₂

InChI: InChI=1/C9H9IO2/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-5H,1-2H3

SMILES: CC(=O)c1ccc(c(c1)I)OC

Synonyms:

• 1-(3-Iodo-4-methoxyphenyl)ethanone
• Ethanone, 1-(3-Iodo-4-Methoxyphenyl)-
• 1-(3-Iodo-4-methoxy-phenyl)-ethanone

1-(3-Iodo-4-methoxyphenyl)ethanone

CAS: 79324-77-9

Formula: C₉H₉IO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 276.0710

Ref: IN-DA003ISH

3'-Iodo-4'-methoxyacetophenone

CAS: 79324-77-9

3'-Iodo-4'-methoxyacetophenone

Purity: 97%

Ref: 54-OR13025

1-(3-Iodo-4-methoxyphenyl)ethan-1-one

CAS: 79324-77-9

1-(3-Iodo-4-methoxyphenyl)ethan-1-one

Purity: 98%

Molecular weight: 276.07g/mol

Ref: 54-OR89713

3'-Iodo-4'-methoxyacetophenone

CAS: 79324-77-9

3'-Iodo-4'-methoxyacetophenone is a chemical compound that is used in the synthesis of other organic compounds. It is a byproduct of the reaction between acetophenone and iodomethane. 3'-Iodo-4'-methoxyacetophenone is soluble in most solvents, such as ethanol, ether, chloroform, and acetone. The compound has a CAS number of 79324-77-9.

Formula: C₉H₉IO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 276.07 g/mol

Ref: 3D-FI55447

1-(3-Iodo-4-methoxyphenyl)ethanone

CAS: 79324-77-9

Formula: C₉H₉IO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 276.073

Ref: 10-F337015