
CAS 79324-78-0
:1-[3-Bromo-4-(methylthio)phenyl]ethanone
Description:
1-[3-Bromo-4-(methylthio)phenyl]ethanone, with the CAS number 79324-78-0, is an organic compound characterized by its aromatic structure and functional groups. It features a bromine atom and a methylthio group attached to a phenyl ring, along with a ketone functional group (ethanone) that contributes to its reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its hydrophobic aromatic nature. The presence of the bromine atom can enhance its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The methylthio group may also influence its electronic properties and reactivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals or agrochemicals, depending on its reactivity and the specific transformations it can undergo.
Formula:C9H9BrOS
InChI:InChI=1S/C9H9BrOS/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-5H,1-2H3
InChI key:InChIKey=CBTKWQDQVWVZQK-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=CC(Br)=C(SC)C=C1
Synonyms:- 1-(3-Bromo-4-methylsulfanylphenyl)ethanone
- 1-[3-Bromo-4-(methylthio)phenyl]ethanone
- 3-Bromo-4-methylthioacetophenone
- 1-[3-Bromo-4-(methylsulfanyl)phenyl]ethan-1-one
- Ethanone, 1-[3-bromo-4-(methylthio)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.