CAS 79326-99-1

Benzenesulfonic acid, 2,4,6-trimethyl-, hydrate (1:1)

Description:

Benzenesulfonic acid, 2,4,6-trimethyl-, hydrate (1:1) is an aromatic sulfonic acid characterized by the presence of a sulfonic acid group (-SO3H) attached to a benzene ring that is further substituted with three methyl groups at the 2, 4, and 6 positions. This compound is typically a white to off-white solid and is soluble in water due to the hydrophilic sulfonic acid group. The presence of the methyl groups contributes to its hydrophobic character, influencing its solubility and reactivity. As a sulfonic acid, it exhibits acidic properties, making it useful in various chemical reactions and applications, including as a catalyst or in the synthesis of dyes and surfactants. The hydrate form indicates that it contains water molecules in its structure, which can affect its stability and solubility. Overall, this compound is significant in organic synthesis and industrial applications due to its unique structural features and functional properties.

Formula: C₉H₁₂O₃S·H₂O

InChI: InChI=1S/C9H12O3S.H2O/c1-6-4-7(2)9(8(3)5-6)13(10,11)12;/h4-5H,1-3H3,(H,10,11,12);1H2

InChI key: InChIKey=XNOZTDZTNOUJFT-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)C1=C(C)C=C(C)C=C1C.O

Synonyms:

• Benzenesulfonic acid, 2,4,6-trimethyl-, hydrate (1:1)
• Mesitylenesulfonic acid monohydrate
• Benzenesulfonic acid, 2,4,6-trimethyl-, monohydrate

Mesitylenesulphonic acid hydrate

CAS: 79326-99-1

Mesitylenesulphonic acid hydrate is a high quality chemical that is used as a reagent, complex compound and useful intermediate. It can be used in the production of fine chemicals, research chemicals, speciality chemicals and versatile building blocks. Mesitylenesulphonic acid hydrate has CAS No. 79326-99-1 and is a speciality chemical that can be used as a reaction component for the production of important compounds such as pharmaceuticals, pesticides and herbicides.

Formula: C₉H₁₂O₃S·xH₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 200.26 g/mol

Ref: 3D-FM37032