CymitQuimica logo

CAS 79348-71-3

:

2,4,6-Trifluorotoluene

Description:
2,4,6-Trifluorotoluene is an aromatic compound characterized by the presence of three fluorine atoms and a methyl group attached to a benzene ring. Its molecular formula is C7H4F3, indicating it has a relatively low molecular weight. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is known for its moderate volatility and low solubility in water, while being more soluble in organic solvents. 2,4,6-Trifluorotoluene exhibits chemical stability under standard conditions but can undergo reactions typical of aromatic compounds, such as electrophilic substitution. The presence of fluorine atoms enhances its chemical reactivity and influences its physical properties, including increased electronegativity and potential for hydrogen bonding. This compound is utilized in various applications, including as a solvent and in the synthesis of other fluorinated compounds. Safety precautions are necessary when handling it, as it may pose health risks through inhalation or skin contact.
Formula:C7H5F3
InChI:InChI=1/C7H5F3/c1-4-6(9)2-5(8)3-7(4)10/h2-3H,1H3
SMILES:Cc1c(cc(cc1F)F)F
Synonyms:
  • 1,3,5-Trifluoro-2-Methylbenzene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.